C19H21FN2O3 — CID 122438217
(3S)-4-[1-(4-fluorophenyl)ethyl]-N-hydroxy-3-methyl-3,5-dihydro-2H-1,4-benzoxazepine-8-carboxamide (PubChem CID 122438217) has the molecular formula C19H21FN2O3 and a molecular weight of 344.39 g/mol. Its IUPAC name is (3S)-4-[1-(4-fluorophenyl)ethyl]-N-hydroxy-3-methyl-3,5-dihydro-2H-1,4-benzoxazepine-8-carboxamide.
| Compound Name | (3S)-4-[1-(4-fluorophenyl)ethyl]-N-hydroxy-3-methyl-3,5-dihydro-2H-1,4-benzoxazepine-8-carboxamide |
|---|---|
| PubChem CID | 122438217 |
| Molecular Formula | C19H21FN2O3 |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | (3S)-4-[1-(4-fluorophenyl)ethyl]-N-hydroxy-3-methyl-3,5-dihydro-2H-1,4-benzoxazepine-8-carboxamide |
| SMILES | CC(c1ccc(F)cc1)N1Cc2ccc(C(=O)NO)cc2OC[C@@H]1C |
| InChI | InChI=1S/C19H21FN2O3/c1-12-11-25-18-9-15(19(23)21-24)3-4-16(18)10-22(12)13(2)14-5-7-17(20)8-6-14/h3-9,12-13,24H,10-11H2,1-2H3,(H,21,23)/t12-,13?/m0/s1 |
| InChIKey | YKMFJWDOHRYELV-UEWDXFNNSA-N |
| XLogP | 3.29 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|