C21H23N3O3S — CID 122438675
N-[(1S,2S)-2-(1,3-benzothiazol-2-ylamino)cyclopentyl]-2,6-dimethoxybenzamide (PubChem CID 122438675) has the molecular formula C21H23N3O3S and a molecular weight of 397.50 g/mol. Its IUPAC name is N-[(1S,2S)-2-(1,3-benzothiazol-2-ylamino)cyclopentyl]-2,6-dimethoxybenzamide.
| Compound Name | N-[(1S,2S)-2-(1,3-benzothiazol-2-ylamino)cyclopentyl]-2,6-dimethoxybenzamide |
|---|---|
| PubChem CID | 122438675 |
| Molecular Formula | C21H23N3O3S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | N-[(1S,2S)-2-(1,3-benzothiazol-2-ylamino)cyclopentyl]-2,6-dimethoxybenzamide |
| SMILES | COc1cccc(OC)c1C(=O)N[C@H]1CCC[C@@H]1Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C21H23N3O3S/c1-26-16-10-6-11-17(27-2)19(16)20(25)22-13-8-5-9-14(13)23-21-24-15-7-3-4-12-18(15)28-21/h3-4,6-7,10-14H,5,8-9H2,1-2H3,(H,22,25)(H,23,24)/t13-,14-/m0/s1 |
| InChIKey | PQSRJJBKNVQRDI-KBPBESRZSA-N |
| XLogP | 4.08 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |