C23H27N3O4 — CID 122438809
N-[(1S,2R)-2-(1,3-benzoxazol-2-ylamino)cyclopentyl]-2,6-diethoxybenzamide (PubChem CID 122438809) has the molecular formula C23H27N3O4 and a molecular weight of 409.49 g/mol. Its IUPAC name is N-[(1S,2R)-2-(1,3-benzoxazol-2-ylamino)cyclopentyl]-2,6-diethoxybenzamide.
| Compound Name | N-[(1S,2R)-2-(1,3-benzoxazol-2-ylamino)cyclopentyl]-2,6-diethoxybenzamide |
|---|---|
| PubChem CID | 122438809 |
| Molecular Formula | C23H27N3O4 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | N-[(1S,2R)-2-(1,3-benzoxazol-2-ylamino)cyclopentyl]-2,6-diethoxybenzamide |
| SMILES | CCOc1cccc(OCC)c1C(=O)N[C@H]1CCC[C@H]1Nc1nc2ccccc2o1 |
| InChI | InChI=1S/C23H27N3O4/c1-3-28-19-13-8-14-20(29-4-2)21(19)22(27)24-15-10-7-11-16(15)25-23-26-17-9-5-6-12-18(17)30-23/h5-6,8-9,12-16H,3-4,7,10-11H2,1-2H3,(H,24,27)(H,25,26)/t15-,16+/m0/s1 |
| InChIKey | BQOYPIIQOXEPGR-JKSUJKDBSA-N |
| XLogP | 4.39 |
| TPSA | 85.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |