C26H24FN7O2S — CID 122438964
N-[3-fluoro-4-(3-methylpiperazin-1-yl)phenyl]-7-quinolin-8-ylsulfonylpyrrolo[2,3-d]pyrimidin-2-amine (PubChem CID 122438964) has the molecular formula C26H24FN7O2S and a molecular weight of 517.59 g/mol. Its IUPAC name is N-[3-fluoro-4-(3-methylpiperazin-1-yl)phenyl]-7-quinolin-8-ylsulfonylpyrrolo[2,3-d]pyrimidin-2-amine.
| Compound Name | N-[3-fluoro-4-(3-methylpiperazin-1-yl)phenyl]-7-quinolin-8-ylsulfonylpyrrolo[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 122438964 |
| Molecular Formula | C26H24FN7O2S |
| Molecular Weight | 517.59 g/mol |
| Exact Mass | 517.17 |
| IUPAC Name | N-[3-fluoro-4-(3-methylpiperazin-1-yl)phenyl]-7-quinolin-8-ylsulfonylpyrrolo[2,3-d]pyrimidin-2-amine |
| SMILES | CC1CN(c2ccc(Nc3ncc4ccn(S(=O)(=O)c5cccc6cccnc56)c4n3)cc2F)CCN1 |
| InChI | InChI=1S/C26H24FN7O2S/c1-17-16-33(13-11-28-17)22-8-7-20(14-21(22)27)31-26-30-15-19-9-12-34(25(19)32-26)37(35,36)23-6-2-4-18-5-3-10-29-24(18)23/h2-10,12,14-15,17,28H,11,13,16H2,1H3,(H,30,31,32) |
| InChIKey | IWYTVGCTEUVJSH-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 105.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.59 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|