C28H30FN7O2S — CID 122439029
N-[3-fluoro-4-(3-methylpiperazin-1-yl)phenyl]-5,5-dimethyl-7-quinolin-8-ylsulfonyl-6H-pyrrolo[2,3-d]pyrimidin-2-amine (PubChem CID 122439029) has the molecular formula C28H30FN7O2S and a molecular weight of 547.66 g/mol. Its IUPAC name is N-[3-fluoro-4-(3-methylpiperazin-1-yl)phenyl]-5,5-dimethyl-7-quinolin-8-ylsulfonyl-6H-pyrrolo[2,3-d]pyrimidin-2-amine.
| Compound Name | N-[3-fluoro-4-(3-methylpiperazin-1-yl)phenyl]-5,5-dimethyl-7-quinolin-8-ylsulfonyl-6H-pyrrolo[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 122439029 |
| Molecular Formula | C28H30FN7O2S |
| Molecular Weight | 547.66 g/mol |
| Exact Mass | 547.22 |
| IUPAC Name | N-[3-fluoro-4-(3-methylpiperazin-1-yl)phenyl]-5,5-dimethyl-7-quinolin-8-ylsulfonyl-6H-pyrrolo[2,3-d]pyrimidin-2-amine |
| SMILES | CC1CN(c2ccc(Nc3ncc4c(n3)N(S(=O)(=O)c3cccc5cccnc35)CC4(C)C)cc2F)CCN1 |
| InChI | InChI=1S/C28H30FN7O2S/c1-18-16-35(13-12-30-18)23-10-9-20(14-22(23)29)33-27-32-15-21-26(34-27)36(17-28(21,2)3)39(37,38)24-8-4-6-19-7-5-11-31-25(19)24/h4-11,14-15,18,30H,12-13,16-17H2,1-3H3,(H,32,33,34) |
| InChIKey | HLJVZULPHJJYRO-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 103.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.66 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|