About (6S)-2,2-difluoro-5-azaspiro[2.4]heptane-5,6-dicarboxylic acid
(6S)-2,2-difluoro-5-azaspiro[2.4]heptane-5,6-dicarboxylic acid (PubChem CID 122439624) has the molecular formula C8H9F2NO4
and a molecular weight of 221.16 g/mol. Its IUPAC name is (6S)-2,2-difluoro-5-azaspiro[2.4]heptane-5,6-dicarboxylic acid.
Molecular Properties
| Compound Name | (6S)-2,2-difluoro-5-azaspiro[2.4]heptane-5,6-dicarboxylic acid |
| PubChem CID | 122439624 |
| Molecular Formula | C8H9F2NO4 |
| Molecular Weight | 221.16 g/mol |
| Exact Mass | 221.05 |
| IUPAC Name | (6S)-2,2-difluoro-5-azaspiro[2.4]heptane-5,6-dicarboxylic acid |
| SMILES | O=C(O)[C@@H]1CC2(CN1C(=O)O)CC2(F)F |
| InChI | InChI=1S/C8H9F2NO4/c9-8(10)2-7(8)1-4(5(12)13)11(3-7)6(14)15/h4H,1-3H2,(H,12,13)(H,14,15)/t4-,7?/m0/s1 |
| InChIKey | IAXRFDJSLSIPPM-LRYVRFSDSA-N |
| XLogP | 0.85 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.16 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (6S)-2,2-difluoro-5-azaspiro[2.4]heptane-5,6-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6S)-2,2-difluoro-5-azaspiro[2.4]heptane-5,6-dicarboxylic acid?
The IUPAC name of (6S)-2,2-difluoro-5-azaspiro[2.4]heptane-5,6-dicarboxylic acid (CID 122439624) is (6S)-2,2-difluoro-5-azaspiro[2.4]heptane-5,6-dicarboxylic acid.
What is the SMILES notation for (6S)-2,2-difluoro-5-azaspiro[2.4]heptane-5,6-dicarboxylic acid?
The canonical SMILES for (6S)-2,2-difluoro-5-azaspiro[2.4]heptane-5,6-dicarboxylic acid is O=C(O)[C@@H]1CC2(CN1C(=O)O)CC2(F)F.
What is the InChIKey of (6S)-2,2-difluoro-5-azaspiro[2.4]heptane-5,6-dicarboxylic acid?
The InChIKey is IAXRFDJSLSIPPM-LRYVRFSDSA-N. The full InChI is InChI=1S/C8H9F2NO4/c9-8(10)2-7(8)1-4(5(12)13)11(3-7)6(14)15/h4H,1-3H2,(H,12,13)(H,14,15)/t4-,7?/m0/s1.
What are the key properties of (6S)-2,2-difluoro-5-azaspiro[2.4]heptane-5,6-dicarboxylic acid?
(6S)-2,2-difluoro-5-azaspiro[2.4]heptane-5,6-dicarboxylic acid has a molecular weight of 221.16 g/mol, XLogP of 0.85, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6S)-2,2-difluoro-5-azaspiro[2.4]heptane-5,6-dicarboxylic acid is sourced from PubChem (CID 122439624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).