C20H22FNO5S — CID 122439745
methyl 1-(4-fluorophenyl)sulfonyl-2-(phenylmethoxymethyl)pyrrolidine-2-carboxylate (PubChem CID 122439745) has the molecular formula C20H22FNO5S and a molecular weight of 407.46 g/mol. Its IUPAC name is methyl 1-(4-fluorophenyl)sulfonyl-2-(phenylmethoxymethyl)pyrrolidine-2-carboxylate.
| Compound Name | methyl 1-(4-fluorophenyl)sulfonyl-2-(phenylmethoxymethyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 122439745 |
| Molecular Formula | C20H22FNO5S |
| Molecular Weight | 407.46 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | methyl 1-(4-fluorophenyl)sulfonyl-2-(phenylmethoxymethyl)pyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1(COCc2ccccc2)CCCN1S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H22FNO5S/c1-26-19(23)20(15-27-14-16-6-3-2-4-7-16)12-5-13-22(20)28(24,25)18-10-8-17(21)9-11-18/h2-4,6-11H,5,12-15H2,1H3 |
| InChIKey | GDJAUEQSTZSFKK-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.46 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |