C12H10Cl2F3NO3 — CID 122439965
ethyl 2-[(5,6-dichloro-3-pyridinyl)methyl]-4,4,4-trifluoro-3-oxobutanoate (PubChem CID 122439965) has the molecular formula C12H10Cl2F3NO3 and a molecular weight of 344.12 g/mol. Its IUPAC name is ethyl 2-[(5,6-dichloro-3-pyridinyl)methyl]-4,4,4-trifluoro-3-oxobutanoate.
| Compound Name | ethyl 2-[(5,6-dichloro-3-pyridinyl)methyl]-4,4,4-trifluoro-3-oxobutanoate |
|---|---|
| PubChem CID | 122439965 |
| Molecular Formula | C12H10Cl2F3NO3 |
| Molecular Weight | 344.12 g/mol |
| Exact Mass | 343.00 |
| IUPAC Name | ethyl 2-[(5,6-dichloro-3-pyridinyl)methyl]-4,4,4-trifluoro-3-oxobutanoate |
| SMILES | CCOC(=O)C(Cc1cnc(Cl)c(Cl)c1)C(=O)C(F)(F)F |
| InChI | InChI=1S/C12H10Cl2F3NO3/c1-2-21-11(20)7(9(19)12(15,16)17)3-6-4-8(13)10(14)18-5-6/h4-5,7H,2-3H2,1H3 |
| InChIKey | DBRFEJUTLORREV-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.12 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|