C14H11ClF6O3 — CID 122439970
ethyl 2-[[4-chloro-3-(trifluoromethyl)phenyl]methyl]-4,4,4-trifluoro-3-oxobutanoate (PubChem CID 122439970) has the molecular formula C14H11ClF6O3 and a molecular weight of 376.68 g/mol. Its IUPAC name is ethyl 2-[[4-chloro-3-(trifluoromethyl)phenyl]methyl]-4,4,4-trifluoro-3-oxobutanoate.
| Compound Name | ethyl 2-[[4-chloro-3-(trifluoromethyl)phenyl]methyl]-4,4,4-trifluoro-3-oxobutanoate |
|---|---|
| PubChem CID | 122439970 |
| Molecular Formula | C14H11ClF6O3 |
| Molecular Weight | 376.68 g/mol |
| Exact Mass | 376.03 |
| IUPAC Name | ethyl 2-[[4-chloro-3-(trifluoromethyl)phenyl]methyl]-4,4,4-trifluoro-3-oxobutanoate |
| SMILES | CCOC(=O)C(Cc1ccc(Cl)c(C(F)(F)F)c1)C(=O)C(F)(F)F |
| InChI | InChI=1S/C14H11ClF6O3/c1-2-24-12(23)8(11(22)14(19,20)21)5-7-3-4-10(15)9(6-7)13(16,17)18/h3-4,6,8H,2,5H2,1H3 |
| InChIKey | AWWHWNRBCPEELR-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.68 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|