C16H21N3O4 — CID 122440253
4-(cyclohexanecarbonyl)-N-hydroxy-3,5-dihydro-2H-pyrido[2,3-f][1,4]oxazepine-8-carboxamide (PubChem CID 122440253) has the molecular formula C16H21N3O4 and a molecular weight of 319.36 g/mol. Its IUPAC name is 4-(cyclohexanecarbonyl)-N-hydroxy-3,5-dihydro-2H-pyrido[2,3-f][1,4]oxazepine-8-carboxamide.
| Compound Name | 4-(cyclohexanecarbonyl)-N-hydroxy-3,5-dihydro-2H-pyrido[2,3-f][1,4]oxazepine-8-carboxamide |
|---|---|
| PubChem CID | 122440253 |
| Molecular Formula | C16H21N3O4 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 4-(cyclohexanecarbonyl)-N-hydroxy-3,5-dihydro-2H-pyrido[2,3-f][1,4]oxazepine-8-carboxamide |
| SMILES | O=C(NO)c1cnc2c(c1)OCCN(C(=O)C1CCCCC1)C2 |
| InChI | InChI=1S/C16H21N3O4/c20-15(18-22)12-8-14-13(17-9-12)10-19(6-7-23-14)16(21)11-4-2-1-3-5-11/h8-9,11,22H,1-7,10H2,(H,18,20) |
| InChIKey | HEEGZOHHWYSEIB-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|