C34H49N2O2PS — CID 122440725
dicyclohexyl-[1-[2,4,6-tri(propan-2-yl)phenyl]sulfonylbenzimidazol-2-yl]phosphane (PubChem CID 122440725) has the molecular formula C34H49N2O2PS and a molecular weight of 580.82 g/mol. Its IUPAC name is dicyclohexyl-[1-[2,4,6-tri(propan-2-yl)phenyl]sulfonylbenzimidazol-2-yl]phosphane.
| Compound Name | dicyclohexyl-[1-[2,4,6-tri(propan-2-yl)phenyl]sulfonylbenzimidazol-2-yl]phosphane |
|---|---|
| PubChem CID | 122440725 |
| Molecular Formula | C34H49N2O2PS |
| Molecular Weight | 580.82 g/mol |
| Exact Mass | 580.33 |
| IUPAC Name | dicyclohexyl-[1-[2,4,6-tri(propan-2-yl)phenyl]sulfonylbenzimidazol-2-yl]phosphane |
| SMILES | CC(C)c1cc(C(C)C)c(S(=O)(=O)n2c(P(C3CCCCC3)C3CCCCC3)nc3ccccc32)c(C(C)C)c1 |
| InChI | InChI=1S/C34H49N2O2PS/c1-23(2)26-21-29(24(3)4)33(30(22-26)25(5)6)40(37,38)36-32-20-14-13-19-31(32)35-34(36)39(27-15-9-7-10-16-27)28-17-11-8-12-18-28/h13-14,19-25,27-28H,7-12,15-18H2,1-6H3 |
| InChIKey | BPAKHABUHHZADN-UHFFFAOYSA-N |
| XLogP | 9.42 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.82 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|