About 3-[1-[1-[(2,6-difluorophenyl)methyl]triazol-4-yl]-2H-pyridin-4-yl]propanamide
3-[1-[1-[(2,6-difluorophenyl)methyl]triazol-4-yl]-2H-pyridin-4-yl]propanamide (PubChem CID 122441034) has the molecular formula C17H17F2N5O
and a molecular weight of 345.35 g/mol. Its IUPAC name is 3-[1-[1-[(2,6-difluorophenyl)methyl]triazol-4-yl]-2H-pyridin-4-yl]propanamide.
Molecular Properties
| Compound Name | 3-[1-[1-[(2,6-difluorophenyl)methyl]triazol-4-yl]-2H-pyridin-4-yl]propanamide |
| PubChem CID | 122441034 |
| Molecular Formula | C17H17F2N5O |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 3-[1-[1-[(2,6-difluorophenyl)methyl]triazol-4-yl]-2H-pyridin-4-yl]propanamide |
| SMILES | NC(=O)CCC1=CCN(c2cn(Cc3c(F)cccc3F)nn2)C=C1 |
| InChI | InChI=1S/C17H17F2N5O/c18-14-2-1-3-15(19)13(14)10-24-11-17(21-22-24)23-8-6-12(7-9-23)4-5-16(20)25/h1-3,6-8,11H,4-5,9-10H2,(H2,20,25) |
| InChIKey | OIZIWVXRWWOLNG-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[1-[1-[(2,6-difluorophenyl)methyl]triazol-4-yl]-2H-pyridin-4-yl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-[1-[(2,6-difluorophenyl)methyl]triazol-4-yl]-2H-pyridin-4-yl]propanamide?
The IUPAC name of 3-[1-[1-[(2,6-difluorophenyl)methyl]triazol-4-yl]-2H-pyridin-4-yl]propanamide (CID 122441034) is 3-[1-[1-[(2,6-difluorophenyl)methyl]triazol-4-yl]-2H-pyridin-4-yl]propanamide.
What is the SMILES notation for 3-[1-[1-[(2,6-difluorophenyl)methyl]triazol-4-yl]-2H-pyridin-4-yl]propanamide?
The canonical SMILES for 3-[1-[1-[(2,6-difluorophenyl)methyl]triazol-4-yl]-2H-pyridin-4-yl]propanamide is NC(=O)CCC1=CCN(c2cn(Cc3c(F)cccc3F)nn2)C=C1.
What is the InChIKey of 3-[1-[1-[(2,6-difluorophenyl)methyl]triazol-4-yl]-2H-pyridin-4-yl]propanamide?
The InChIKey is OIZIWVXRWWOLNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17F2N5O/c18-14-2-1-3-15(19)13(14)10-24-11-17(21-22-24)23-8-6-12(7-9-23)4-5-16(20)25/h1-3,6-8,11H,4-5,9-10H2,(H2,20,25).
What are the key properties of 3-[1-[1-[(2,6-difluorophenyl)methyl]triazol-4-yl]-2H-pyridin-4-yl]propanamide?
3-[1-[1-[(2,6-difluorophenyl)methyl]triazol-4-yl]-2H-pyridin-4-yl]propanamide has a molecular weight of 345.35 g/mol, XLogP of 2.13, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-[1-[(2,6-difluorophenyl)methyl]triazol-4-yl]-2H-pyridin-4-yl]propanamide is sourced from PubChem (CID 122441034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).