About 2-(4-phenylmethoxyphenyl)-N-(piperidin-4-ylmethyl)-1H-imidazo[4,5-b]pyridin-5-amine
2-(4-phenylmethoxyphenyl)-N-(piperidin-4-ylmethyl)-1H-imidazo[4,5-b]pyridin-5-amine (PubChem CID 122441864) has the molecular formula C25H27N5O
and a molecular weight of 413.53 g/mol. Its IUPAC name is 2-(4-phenylmethoxyphenyl)-N-(piperidin-4-ylmethyl)-1H-imidazo[4,5-b]pyridin-5-amine.
Molecular Properties
| Compound Name | 2-(4-phenylmethoxyphenyl)-N-(piperidin-4-ylmethyl)-1H-imidazo[4,5-b]pyridin-5-amine |
| PubChem CID | 122441864 |
| Molecular Formula | C25H27N5O |
| Molecular Weight | 413.53 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | 2-(4-phenylmethoxyphenyl)-N-(piperidin-4-ylmethyl)-1H-imidazo[4,5-b]pyridin-5-amine |
| SMILES | c1ccc(COc2ccc(-c3nc4nc(NCC5CCNCC5)ccc4[nH]3)cc2)cc1 |
| InChI | InChI=1S/C25H27N5O/c1-2-4-19(5-3-1)17-31-21-8-6-20(7-9-21)24-28-22-10-11-23(29-25(22)30-24)27-16-18-12-14-26-15-13-18/h1-11,18,26H,12-17H2,(H2,27,28,29,30) |
| InChIKey | NSNURMPVCVKAFQ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 74.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.53 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(4-phenylmethoxyphenyl)-N-(piperidin-4-ylmethyl)-1H-imidazo[4,5-b]pyridin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-phenylmethoxyphenyl)-N-(piperidin-4-ylmethyl)-1H-imidazo[4,5-b]pyridin-5-amine?
The IUPAC name of 2-(4-phenylmethoxyphenyl)-N-(piperidin-4-ylmethyl)-1H-imidazo[4,5-b]pyridin-5-amine (CID 122441864) is 2-(4-phenylmethoxyphenyl)-N-(piperidin-4-ylmethyl)-1H-imidazo[4,5-b]pyridin-5-amine.
What is the SMILES notation for 2-(4-phenylmethoxyphenyl)-N-(piperidin-4-ylmethyl)-1H-imidazo[4,5-b]pyridin-5-amine?
The canonical SMILES for 2-(4-phenylmethoxyphenyl)-N-(piperidin-4-ylmethyl)-1H-imidazo[4,5-b]pyridin-5-amine is c1ccc(COc2ccc(-c3nc4nc(NCC5CCNCC5)ccc4[nH]3)cc2)cc1.
What is the InChIKey of 2-(4-phenylmethoxyphenyl)-N-(piperidin-4-ylmethyl)-1H-imidazo[4,5-b]pyridin-5-amine?
The InChIKey is NSNURMPVCVKAFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H27N5O/c1-2-4-19(5-3-1)17-31-21-8-6-20(7-9-21)24-28-22-10-11-23(29-25(22)30-24)27-16-18-12-14-26-15-13-18/h1-11,18,26H,12-17H2,(H2,27,28,29,30).
What are the key properties of 2-(4-phenylmethoxyphenyl)-N-(piperidin-4-ylmethyl)-1H-imidazo[4,5-b]pyridin-5-amine?
2-(4-phenylmethoxyphenyl)-N-(piperidin-4-ylmethyl)-1H-imidazo[4,5-b]pyridin-5-amine has a molecular weight of 413.53 g/mol, XLogP of 4.62, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-phenylmethoxyphenyl)-N-(piperidin-4-ylmethyl)-1H-imidazo[4,5-b]pyridin-5-amine is sourced from PubChem (CID 122441864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).