C18H16N2O3S — CID 122442001
5-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)quinolin-8-ol (PubChem CID 122442001) has the molecular formula C18H16N2O3S and a molecular weight of 340.40 g/mol. Its IUPAC name is 5-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)quinolin-8-ol.
| Compound Name | 5-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)quinolin-8-ol |
|---|---|
| PubChem CID | 122442001 |
| Molecular Formula | C18H16N2O3S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | 5-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)quinolin-8-ol |
| SMILES | O=S(=O)(c1ccc(O)c2ncccc12)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C18H16N2O3S/c21-16-7-8-17(15-6-3-10-19-18(15)16)24(22,23)20-11-9-13-4-1-2-5-14(13)12-20/h1-8,10,21H,9,11-12H2 |
| InChIKey | HEKZRCXBIXZYSL-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |