C20H17F3N4O2 — CID 122442120
2-[3-(2,2-difluoroethoxy)-4-pyridinyl]-3-(3-fluoroanilino)-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one (PubChem CID 122442120) has the molecular formula C20H17F3N4O2 and a molecular weight of 402.38 g/mol. Its IUPAC name is 2-[3-(2,2-difluoroethoxy)-4-pyridinyl]-3-(3-fluoroanilino)-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one.
| Compound Name | 2-[3-(2,2-difluoroethoxy)-4-pyridinyl]-3-(3-fluoroanilino)-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 122442120 |
| Molecular Formula | C20H17F3N4O2 |
| Molecular Weight | 402.38 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 2-[3-(2,2-difluoroethoxy)-4-pyridinyl]-3-(3-fluoroanilino)-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one |
| SMILES | O=C1NCCc2[nH]c(-c3ccncc3OCC(F)F)c(Nc3cccc(F)c3)c21 |
| InChI | InChI=1S/C20H17F3N4O2/c21-11-2-1-3-12(8-11)26-19-17-14(5-7-25-20(17)28)27-18(19)13-4-6-24-9-15(13)29-10-16(22)23/h1-4,6,8-9,16,26-27H,5,7,10H2,(H,25,28) |
| InChIKey | BLLDXXIYTCRJCV-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.38 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |