About cyclopropyl-(2,3-dichloro-6-prop-2-enoxyphenyl)methanamine
cyclopropyl-(2,3-dichloro-6-prop-2-enoxyphenyl)methanamine (PubChem CID 122442298) has the molecular formula C13H15Cl2NO
and a molecular weight of 272.18 g/mol. Its IUPAC name is cyclopropyl-(2,3-dichloro-6-prop-2-enoxyphenyl)methanamine.
Molecular Properties
| Compound Name | cyclopropyl-(2,3-dichloro-6-prop-2-enoxyphenyl)methanamine |
| PubChem CID | 122442298 |
| Molecular Formula | C13H15Cl2NO |
| Molecular Weight | 272.18 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | cyclopropyl-(2,3-dichloro-6-prop-2-enoxyphenyl)methanamine |
| SMILES | C=CCOc1ccc(Cl)c(Cl)c1C(N)C1CC1 |
| InChI | InChI=1S/C13H15Cl2NO/c1-2-7-17-10-6-5-9(14)12(15)11(10)13(16)8-3-4-8/h2,5-6,8,13H,1,3-4,7,16H2 |
| InChIKey | GWWPHFBBCDSPTE-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.18 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze cyclopropyl-(2,3-dichloro-6-prop-2-enoxyphenyl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropyl-(2,3-dichloro-6-prop-2-enoxyphenyl)methanamine?
The IUPAC name of cyclopropyl-(2,3-dichloro-6-prop-2-enoxyphenyl)methanamine (CID 122442298) is cyclopropyl-(2,3-dichloro-6-prop-2-enoxyphenyl)methanamine.
What is the SMILES notation for cyclopropyl-(2,3-dichloro-6-prop-2-enoxyphenyl)methanamine?
The canonical SMILES for cyclopropyl-(2,3-dichloro-6-prop-2-enoxyphenyl)methanamine is C=CCOc1ccc(Cl)c(Cl)c1C(N)C1CC1.
What is the InChIKey of cyclopropyl-(2,3-dichloro-6-prop-2-enoxyphenyl)methanamine?
The InChIKey is GWWPHFBBCDSPTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15Cl2NO/c1-2-7-17-10-6-5-9(14)12(15)11(10)13(16)8-3-4-8/h2,5-6,8,13H,1,3-4,7,16H2.
What are the key properties of cyclopropyl-(2,3-dichloro-6-prop-2-enoxyphenyl)methanamine?
cyclopropyl-(2,3-dichloro-6-prop-2-enoxyphenyl)methanamine has a molecular weight of 272.18 g/mol, XLogP of 3.97, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropyl-(2,3-dichloro-6-prop-2-enoxyphenyl)methanamine is sourced from PubChem (CID 122442298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).