C13H15Cl2NO — CID 122442298
cyclopropyl-(2,3-dichloro-6-prop-2-enoxyphenyl)methanamine (PubChem CID 122442298) has the molecular formula C13H15Cl2NO and a molecular weight of 272.18 g/mol. Its IUPAC name is cyclopropyl-(2,3-dichloro-6-prop-2-enoxyphenyl)methanamine.
| Compound Name | cyclopropyl-(2,3-dichloro-6-prop-2-enoxyphenyl)methanamine |
|---|---|
| PubChem CID | 122442298 |
| Molecular Formula | C13H15Cl2NO |
| Molecular Weight | 272.18 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | cyclopropyl-(2,3-dichloro-6-prop-2-enoxyphenyl)methanamine |
| SMILES | C=CCOc1ccc(Cl)c(Cl)c1C(N)C1CC1 |
| InChI | InChI=1S/C13H15Cl2NO/c1-2-7-17-10-6-5-9(14)12(15)11(10)13(16)8-3-4-8/h2,5-6,8,13H,1,3-4,7,16H2 |
| InChIKey | GWWPHFBBCDSPTE-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.18 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|