C22H21F3N4O5S — CID 122443531
N-[4-[(2R,3R,4S,5R,6R)-3,5-dihydroxy-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]sulfanylphenyl]acetamide (PubChem CID 122443531) has the molecular formula C22H21F3N4O5S and a molecular weight of 510.49 g/mol. Its IUPAC name is N-[4-[(2R,3R,4S,5R,6R)-3,5-dihydroxy-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]sulfanylphenyl]acetamide.
| Compound Name | N-[4-[(2R,3R,4S,5R,6R)-3,5-dihydroxy-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]sulfanylphenyl]acetamide |
|---|---|
| PubChem CID | 122443531 |
| Molecular Formula | C22H21F3N4O5S |
| Molecular Weight | 510.49 g/mol |
| Exact Mass | 510.12 |
| IUPAC Name | N-[4-[(2R,3R,4S,5R,6R)-3,5-dihydroxy-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]sulfanylphenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S[C@H]2O[C@H](CO)[C@H](O)[C@H](n3cc(-c4cc(F)c(F)c(F)c4)nn3)[C@H]2O)cc1 |
| InChI | InChI=1S/C22H21F3N4O5S/c1-10(31)26-12-2-4-13(5-3-12)35-22-21(33)19(20(32)17(9-30)34-22)29-8-16(27-28-29)11-6-14(23)18(25)15(24)7-11/h2-8,17,19-22,30,32-33H,9H2,1H3,(H,26,31)/t17-,19+,20+,21-,22-/m1/s1 |
| InChIKey | IOAIBUSJDFUFDE-WHCFWRGISA-N |
| XLogP | 2.09 |
| TPSA | 129.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.49 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|