C20H24F5N3O4S — CID 122443545
(2R,3R,4R,5S,6R)-2-cyclohexylsulfanyl-4-fluoro-4-[3-fluoro-4-(3,4,5-trifluorophenyl)-2H-triazol-1-yl]-6-(hydroxymethyl)oxane-3,5-diol (PubChem CID 122443545) has the molecular formula C20H24F5N3O4S and a molecular weight of 497.49 g/mol. Its IUPAC name is (2R,3R,4R,5S,6R)-2-cyclohexylsulfanyl-4-fluoro-4-[3-fluoro-4-(3,4,5-trifluorophenyl)-2H-triazol-1-yl]-6-(hydroxymethyl)oxane-3,5-diol.
| Compound Name | (2R,3R,4R,5S,6R)-2-cyclohexylsulfanyl-4-fluoro-4-[3-fluoro-4-(3,4,5-trifluorophenyl)-2H-triazol-1-yl]-6-(hydroxymethyl)oxane-3,5-diol |
|---|---|
| PubChem CID | 122443545 |
| Molecular Formula | C20H24F5N3O4S |
| Molecular Weight | 497.49 g/mol |
| Exact Mass | 497.14 |
| IUPAC Name | (2R,3R,4R,5S,6R)-2-cyclohexylsulfanyl-4-fluoro-4-[3-fluoro-4-(3,4,5-trifluorophenyl)-2H-triazol-1-yl]-6-(hydroxymethyl)oxane-3,5-diol |
| SMILES | OC[C@H]1O[C@H](SC2CCCCC2)[C@H](O)[C@@](F)(N2C=C(c3cc(F)c(F)c(F)c3)N(F)N2)[C@H]1O |
| InChI | InChI=1S/C20H24F5N3O4S/c21-12-6-10(7-13(22)16(12)23)14-8-27(26-28(14)25)20(24)17(30)15(9-29)32-19(18(20)31)33-11-4-2-1-3-5-11/h6-8,11,15,17-19,26,29-31H,1-5,9H2/t15-,17+,18+,19-,20+/m1/s1 |
| InChIKey | OGMLPOFQURJLMV-ZKIDJSGLSA-N |
| XLogP | 2.49 |
| TPSA | 88.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.49 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|