C47H27Li2N5O2 — CID 122443720
dilithium;5-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-10-(8-oxidoquinolin-5-yl)anthracen-9-yl]quinolin-8-olate (PubChem CID 122443720) has the molecular formula C47H27Li2N5O2 and a molecular weight of 707.65 g/mol. Its IUPAC name is dilithium;5-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-10-(8-oxidoquinolin-5-yl)anthracen-9-yl]quinolin-8-olate.
| Compound Name | dilithium;5-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-10-(8-oxidoquinolin-5-yl)anthracen-9-yl]quinolin-8-olate |
|---|---|
| PubChem CID | 122443720 |
| Molecular Formula | C47H27Li2N5O2 |
| Molecular Weight | 707.65 g/mol |
| Exact Mass | 707.25 |
| IUPAC Name | dilithium;5-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-10-(8-oxidoquinolin-5-yl)anthracen-9-yl]quinolin-8-olate |
| SMILES | [Li+].[Li+].[O-]c1ccc(-c2c3ccccc3c(-c3ccc([O-])c4ncccc34)c3cc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)ccc23)c2cccnc12 |
| InChI | InChI=1S/C47H29N5O2.2Li/c53-39-23-21-33(36-17-9-25-48-43(36)39)41-31-15-7-8-16-32(31)42(34-22-24-40(54)44-37(34)18-10-26-49-44)38-27-30(19-20-35(38)41)47-51-45(28-11-3-1-4-12-28)50-46(52-47)29-13-5-2-6-14-29;;/h1-27,53-54H;;/q;2*+1/p-2 |
| InChIKey | UWFCVXRGBMIIEG-UHFFFAOYSA-L |
| XLogP | 3.76 |
| TPSA | 110.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 56 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.65 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|