C17H30N4O2 — CID 122444310
4-N-methyl-4-N-[(2,6,6-trimethylcyclohexen-1-yl)methyl]piperazine-1,4-dicarboxamide (PubChem CID 122444310) has the molecular formula C17H30N4O2 and a molecular weight of 322.45 g/mol. Its IUPAC name is 4-N-methyl-4-N-[(2,6,6-trimethylcyclohexen-1-yl)methyl]piperazine-1,4-dicarboxamide.
| Compound Name | 4-N-methyl-4-N-[(2,6,6-trimethylcyclohexen-1-yl)methyl]piperazine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 122444310 |
| Molecular Formula | C17H30N4O2 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.24 |
| IUPAC Name | 4-N-methyl-4-N-[(2,6,6-trimethylcyclohexen-1-yl)methyl]piperazine-1,4-dicarboxamide |
| SMILES | CC1=C(CN(C)C(=O)N2CCN(C(N)=O)CC2)C(C)(C)CCC1 |
| InChI | InChI=1S/C17H30N4O2/c1-13-6-5-7-17(2,3)14(13)12-19(4)16(23)21-10-8-20(9-11-21)15(18)22/h5-12H2,1-4H3,(H2,18,22) |
| InChIKey | XSXLPAPRMBACIZ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 69.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|