C10H12F3NO3S — CID 122444723
4,5,6,7-tetrahydrothieno[3,2-c]pyridin-2-ylmethanol;2,2,2-trifluoroacetic acid (PubChem CID 122444723) has the molecular formula C10H12F3NO3S and a molecular weight of 283.27 g/mol. Its IUPAC name is 4,5,6,7-tetrahydrothieno[3,2-c]pyridin-2-ylmethanol;2,2,2-trifluoroacetic acid.
| Compound Name | 4,5,6,7-tetrahydrothieno[3,2-c]pyridin-2-ylmethanol;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 122444723 |
| Molecular Formula | C10H12F3NO3S |
| Molecular Weight | 283.27 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 4,5,6,7-tetrahydrothieno[3,2-c]pyridin-2-ylmethanol;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.OCc1cc2c(s1)CCNC2 |
| InChI | InChI=1S/C8H11NOS.C2HF3O2/c10-5-7-3-6-4-9-2-1-8(6)11-7;3-2(4,5)1(6)7/h3,9-10H,1-2,4-5H2;(H,6,7) |
| InChIKey | GIJLWWLOXUPPTR-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.27 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |