C8H7N3OS — CID 122444728
4-methyl-1-thiophen-2-yl-1,3,5-triazin-2-one (PubChem CID 122444728) has the molecular formula C8H7N3OS and a molecular weight of 193.23 g/mol. Its IUPAC name is 4-methyl-1-thiophen-2-yl-1,3,5-triazin-2-one.
| Compound Name | 4-methyl-1-thiophen-2-yl-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 122444728 |
| Molecular Formula | C8H7N3OS |
| Molecular Weight | 193.23 g/mol |
| Exact Mass | 193.03 |
| IUPAC Name | 4-methyl-1-thiophen-2-yl-1,3,5-triazin-2-one |
| SMILES | Cc1ncn(-c2cccs2)c(=O)n1 |
| InChI | InChI=1S/C8H7N3OS/c1-6-9-5-11(8(12)10-6)7-3-2-4-13-7/h2-5H,1H3 |
| InChIKey | FDFRITTUPDUXAF-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.23 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |