C16H14FN5O2 — CID 122444955
2-amino-N-[(6-fluoro-2-pyridinyl)methyl]-8-methoxyquinazoline-4-carboxamide (PubChem CID 122444955) has the molecular formula C16H14FN5O2 and a molecular weight of 327.32 g/mol. Its IUPAC name is 2-amino-N-[(6-fluoro-2-pyridinyl)methyl]-8-methoxyquinazoline-4-carboxamide.
| Compound Name | 2-amino-N-[(6-fluoro-2-pyridinyl)methyl]-8-methoxyquinazoline-4-carboxamide |
|---|---|
| PubChem CID | 122444955 |
| Molecular Formula | C16H14FN5O2 |
| Molecular Weight | 327.32 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 2-amino-N-[(6-fluoro-2-pyridinyl)methyl]-8-methoxyquinazoline-4-carboxamide |
| SMILES | COc1cccc2c(C(=O)NCc3cccc(F)n3)nc(N)nc12 |
| InChI | InChI=1S/C16H14FN5O2/c1-24-11-6-3-5-10-13(11)21-16(18)22-14(10)15(23)19-8-9-4-2-7-12(17)20-9/h2-7H,8H2,1H3,(H,19,23)(H2,18,21,22) |
| InChIKey | DRQYVTXYDZCVNL-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 103.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.32 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|