C16H10FN5O — CID 122446273
6-fluoro-N-(4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl)pyridine-3-carboxamide (PubChem CID 122446273) has the molecular formula C16H10FN5O and a molecular weight of 307.29 g/mol. Its IUPAC name is 6-fluoro-N-(4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl)pyridine-3-carboxamide.
| Compound Name | 6-fluoro-N-(4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 122446273 |
| Molecular Formula | C16H10FN5O |
| Molecular Weight | 307.29 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 6-fluoro-N-(4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl)pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc2c(n1)[nH]c1ccncc12)c1ccc(F)nc1 |
| InChI | InChI=1S/C16H10FN5O/c17-13-3-1-9(7-19-13)16(23)22-14-4-2-10-11-8-18-6-5-12(11)20-15(10)21-14/h1-8H,(H2,20,21,22,23) |
| InChIKey | WZEQFUCUKWGRSR-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.29 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|