C18H15N5O2 — CID 122446277
5-(5-methoxy-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-11-yl)-N-methylpyridine-2-carboxamide (PubChem CID 122446277) has the molecular formula C18H15N5O2 and a molecular weight of 333.35 g/mol. Its IUPAC name is 5-(5-methoxy-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-11-yl)-N-methylpyridine-2-carboxamide.
| Compound Name | 5-(5-methoxy-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-11-yl)-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 122446277 |
| Molecular Formula | C18H15N5O2 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | 5-(5-methoxy-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-11-yl)-N-methylpyridine-2-carboxamide |
| SMILES | CNC(=O)c1ccc(-c2ccc3c(n2)[nH]c2cc(OC)ncc23)cn1 |
| InChI | InChI=1S/C18H15N5O2/c1-19-18(24)14-5-3-10(8-20-14)13-6-4-11-12-9-21-16(25-2)7-15(12)23-17(11)22-13/h3-9H,1-2H3,(H,19,24)(H,22,23) |
| InChIKey | KWUJWLLUODRIBI-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |