C17H14N6O — CID 122446303
6-(methylamino)-N-(4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl)pyridine-3-carboxamide (PubChem CID 122446303) has the molecular formula C17H14N6O and a molecular weight of 318.34 g/mol. Its IUPAC name is 6-(methylamino)-N-(4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl)pyridine-3-carboxamide.
| Compound Name | 6-(methylamino)-N-(4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 122446303 |
| Molecular Formula | C17H14N6O |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 6-(methylamino)-N-(4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl)pyridine-3-carboxamide |
| SMILES | CNc1ccc(C(=O)Nc2ccc3c(n2)[nH]c2ccncc23)cn1 |
| InChI | InChI=1S/C17H14N6O/c1-18-14-4-2-10(8-20-14)17(24)23-15-5-3-11-12-9-19-7-6-13(12)21-16(11)22-15/h2-9H,1H3,(H,18,20)(H2,21,22,23,24) |
| InChIKey | OUTRYRUWYZKEHF-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |