C17H13FN4O — CID 122446307
11-(6-fluoro-3-pyridinyl)-5-(methoxymethyl)-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 122446307) has the molecular formula C17H13FN4O and a molecular weight of 308.32 g/mol. Its IUPAC name is 11-(6-fluoro-3-pyridinyl)-5-(methoxymethyl)-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 11-(6-fluoro-3-pyridinyl)-5-(methoxymethyl)-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 122446307 |
| Molecular Formula | C17H13FN4O |
| Molecular Weight | 308.32 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 11-(6-fluoro-3-pyridinyl)-5-(methoxymethyl)-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | COCc1cc2[nH]c3nc(-c4ccc(F)nc4)ccc3c2cn1 |
| InChI | InChI=1S/C17H13FN4O/c1-23-9-11-6-15-13(8-19-11)12-3-4-14(21-17(12)22-15)10-2-5-16(18)20-7-10/h2-8H,9H2,1H3,(H,21,22) |
| InChIKey | ABTMZMOUYURBBW-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.32 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|