C20H19N7O — CID 122446312
1-[4-[5-(4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl)pyrimidin-2-yl]piperazin-1-yl]ethanone (PubChem CID 122446312) has the molecular formula C20H19N7O and a molecular weight of 373.42 g/mol. Its IUPAC name is 1-[4-[5-(4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl)pyrimidin-2-yl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[5-(4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl)pyrimidin-2-yl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 122446312 |
| Molecular Formula | C20H19N7O |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | 1-[4-[5-(4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl)pyrimidin-2-yl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(c2ncc(-c3ccc4c(n3)[nH]c3ccncc34)cn2)CC1 |
| InChI | InChI=1S/C20H19N7O/c1-13(28)26-6-8-27(9-7-26)20-22-10-14(11-23-20)17-3-2-15-16-12-21-5-4-18(16)25-19(15)24-17/h2-5,10-12H,6-9H2,1H3,(H,24,25) |
| InChIKey | AMZAKGLBHNPPHZ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |