C30H61NO3S — CID 122446336
prop-2-ene-1-sulfonate;trioctyl(prop-2-enyl)azanium (PubChem CID 122446336) has the molecular formula C30H61NO3S and a molecular weight of 515.89 g/mol. Its IUPAC name is prop-2-ene-1-sulfonate;trioctyl(prop-2-enyl)azanium.
| Compound Name | prop-2-ene-1-sulfonate;trioctyl(prop-2-enyl)azanium |
|---|---|
| PubChem CID | 122446336 |
| Molecular Formula | C30H61NO3S |
| Molecular Weight | 515.89 g/mol |
| Exact Mass | 515.44 |
| IUPAC Name | prop-2-ene-1-sulfonate;trioctyl(prop-2-enyl)azanium |
| SMILES | C=CCS(=O)(=O)[O-].C=CC[N+](CCCCCCCC)(CCCCCCCC)CCCCCCCC |
| InChI | InChI=1S/C27H56N.C3H6O3S/c1-5-9-12-15-18-21-25-28(24-8-4,26-22-19-16-13-10-6-2)27-23-20-17-14-11-7-3;1-2-3-7(4,5)6/h8H,4-7,9-27H2,1-3H3;2H,1,3H2,(H,4,5,6)/q+1;/p-1 |
| InChIKey | OERVFCKAPVTKKE-UHFFFAOYSA-M |
| XLogP | 8.79 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.89 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|