About [1,2-dimethyl-5-(trifluoromethyl)indol-3-yl]methanol
[1,2-dimethyl-5-(trifluoromethyl)indol-3-yl]methanol (PubChem CID 122447050) has the molecular formula C12H12F3NO
and a molecular weight of 243.23 g/mol. Its IUPAC name is [1,2-dimethyl-5-(trifluoromethyl)indol-3-yl]methanol.
Molecular Properties
| Compound Name | [1,2-dimethyl-5-(trifluoromethyl)indol-3-yl]methanol |
| PubChem CID | 122447050 |
| Molecular Formula | C12H12F3NO |
| Molecular Weight | 243.23 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | [1,2-dimethyl-5-(trifluoromethyl)indol-3-yl]methanol |
| SMILES | Cc1c(CO)c2cc(C(F)(F)F)ccc2n1C |
| InChI | InChI=1S/C12H12F3NO/c1-7-10(6-17)9-5-8(12(13,14)15)3-4-11(9)16(7)2/h3-5,17H,6H2,1-2H3 |
| InChIKey | NOWPDTFZACCCMM-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.23 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze [1,2-dimethyl-5-(trifluoromethyl)indol-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,2-dimethyl-5-(trifluoromethyl)indol-3-yl]methanol?
The IUPAC name of [1,2-dimethyl-5-(trifluoromethyl)indol-3-yl]methanol (CID 122447050) is [1,2-dimethyl-5-(trifluoromethyl)indol-3-yl]methanol.
What is the SMILES notation for [1,2-dimethyl-5-(trifluoromethyl)indol-3-yl]methanol?
The canonical SMILES for [1,2-dimethyl-5-(trifluoromethyl)indol-3-yl]methanol is Cc1c(CO)c2cc(C(F)(F)F)ccc2n1C.
What is the InChIKey of [1,2-dimethyl-5-(trifluoromethyl)indol-3-yl]methanol?
The InChIKey is NOWPDTFZACCCMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12F3NO/c1-7-10(6-17)9-5-8(12(13,14)15)3-4-11(9)16(7)2/h3-5,17H,6H2,1-2H3.
What are the key properties of [1,2-dimethyl-5-(trifluoromethyl)indol-3-yl]methanol?
[1,2-dimethyl-5-(trifluoromethyl)indol-3-yl]methanol has a molecular weight of 243.23 g/mol, XLogP of 3.00, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1,2-dimethyl-5-(trifluoromethyl)indol-3-yl]methanol is sourced from PubChem (CID 122447050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).