C21H22N6O4 — CID 122447240
12-methyl-21-oxa-1,9,12,13,16,26-hexazatetracyclo[20.3.1.13,7.010,14]heptacosa-3(27),4,6,10,13,22(26),23-heptaene-8,15,25-trione (PubChem CID 122447240) has the molecular formula C21H22N6O4 and a molecular weight of 422.45 g/mol. Its IUPAC name is 12-methyl-21-oxa-1,9,12,13,16,26-hexazatetracyclo[20.3.1.13,7.010,14]heptacosa-3(27),4,6,10,13,22(26),23-heptaene-8,15,25-trione.
| Compound Name | 12-methyl-21-oxa-1,9,12,13,16,26-hexazatetracyclo[20.3.1.13,7.010,14]heptacosa-3(27),4,6,10,13,22(26),23-heptaene-8,15,25-trione |
|---|---|
| PubChem CID | 122447240 |
| Molecular Formula | C21H22N6O4 |
| Molecular Weight | 422.45 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | 12-methyl-21-oxa-1,9,12,13,16,26-hexazatetracyclo[20.3.1.13,7.010,14]heptacosa-3(27),4,6,10,13,22(26),23-heptaene-8,15,25-trione |
| SMILES | Cn1cc2c(n1)C(=O)NCCCCOc1ccc(=O)n(n1)Cc1cccc(c1)C(=O)N2 |
| InChI | InChI=1S/C21H22N6O4/c1-26-13-16-19(25-26)21(30)22-9-2-3-10-31-17-7-8-18(28)27(24-17)12-14-5-4-6-15(11-14)20(29)23-16/h4-8,11,13H,2-3,9-10,12H2,1H3,(H,22,30)(H,23,29) |
| InChIKey | XHWNTEWYWFMZBL-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 120.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.45 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |