About 6-(5-methoxy-3-pyridinyl)-2-(4-methyl-1H-benzimidazol-2-yl)-1,3-benzoxazole
6-(5-methoxy-3-pyridinyl)-2-(4-methyl-1H-benzimidazol-2-yl)-1,3-benzoxazole (PubChem CID 122447522) has the molecular formula C21H16N4O2
and a molecular weight of 356.39 g/mol. Its IUPAC name is 6-(5-methoxy-3-pyridinyl)-2-(4-methyl-1H-benzimidazol-2-yl)-1,3-benzoxazole.
Molecular Properties
| Compound Name | 6-(5-methoxy-3-pyridinyl)-2-(4-methyl-1H-benzimidazol-2-yl)-1,3-benzoxazole |
| PubChem CID | 122447522 |
| Molecular Formula | C21H16N4O2 |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 6-(5-methoxy-3-pyridinyl)-2-(4-methyl-1H-benzimidazol-2-yl)-1,3-benzoxazole |
| SMILES | COc1cncc(-c2ccc3nc(-c4nc5c(C)cccc5[nH]4)oc3c2)c1 |
| InChI | InChI=1S/C21H16N4O2/c1-12-4-3-5-17-19(12)25-20(23-17)21-24-16-7-6-13(9-18(16)27-21)14-8-15(26-2)11-22-10-14/h3-11H,1-2H3,(H,23,25) |
| InChIKey | RCLIWFLYZFREPS-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 76.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-(5-methoxy-3-pyridinyl)-2-(4-methyl-1H-benzimidazol-2-yl)-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(5-methoxy-3-pyridinyl)-2-(4-methyl-1H-benzimidazol-2-yl)-1,3-benzoxazole?
The IUPAC name of 6-(5-methoxy-3-pyridinyl)-2-(4-methyl-1H-benzimidazol-2-yl)-1,3-benzoxazole (CID 122447522) is 6-(5-methoxy-3-pyridinyl)-2-(4-methyl-1H-benzimidazol-2-yl)-1,3-benzoxazole.
What is the SMILES notation for 6-(5-methoxy-3-pyridinyl)-2-(4-methyl-1H-benzimidazol-2-yl)-1,3-benzoxazole?
The canonical SMILES for 6-(5-methoxy-3-pyridinyl)-2-(4-methyl-1H-benzimidazol-2-yl)-1,3-benzoxazole is COc1cncc(-c2ccc3nc(-c4nc5c(C)cccc5[nH]4)oc3c2)c1.
What is the InChIKey of 6-(5-methoxy-3-pyridinyl)-2-(4-methyl-1H-benzimidazol-2-yl)-1,3-benzoxazole?
The InChIKey is RCLIWFLYZFREPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16N4O2/c1-12-4-3-5-17-19(12)25-20(23-17)21-24-16-7-6-13(9-18(16)27-21)14-8-15(26-2)11-22-10-14/h3-11H,1-2H3,(H,23,25).
What are the key properties of 6-(5-methoxy-3-pyridinyl)-2-(4-methyl-1H-benzimidazol-2-yl)-1,3-benzoxazole?
6-(5-methoxy-3-pyridinyl)-2-(4-methyl-1H-benzimidazol-2-yl)-1,3-benzoxazole has a molecular weight of 356.39 g/mol, XLogP of 4.75, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(5-methoxy-3-pyridinyl)-2-(4-methyl-1H-benzimidazol-2-yl)-1,3-benzoxazole is sourced from PubChem (CID 122447522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).