C70H44N4 — CID 122448075
4-phenanthren-2-yl-6-[4-[5-[4-(6-phenanthren-2-yl-2-phenylpyrimidin-4-yl)phenyl]naphthalen-1-yl]phenyl]-2-phenylpyrimidine (PubChem CID 122448075) has the molecular formula C70H44N4 and a molecular weight of 941.15 g/mol. Its IUPAC name is 4-phenanthren-2-yl-6-[4-[5-[4-(6-phenanthren-2-yl-2-phenylpyrimidin-4-yl)phenyl]naphthalen-1-yl]phenyl]-2-phenylpyrimidine.
| Compound Name | 4-phenanthren-2-yl-6-[4-[5-[4-(6-phenanthren-2-yl-2-phenylpyrimidin-4-yl)phenyl]naphthalen-1-yl]phenyl]-2-phenylpyrimidine |
|---|---|
| PubChem CID | 122448075 |
| Molecular Formula | C70H44N4 |
| Molecular Weight | 941.15 g/mol |
| Exact Mass | 940.36 |
| IUPAC Name | 4-phenanthren-2-yl-6-[4-[5-[4-(6-phenanthren-2-yl-2-phenylpyrimidin-4-yl)phenyl]naphthalen-1-yl]phenyl]-2-phenylpyrimidine |
| SMILES | c1ccc(-c2nc(-c3ccc(-c4cccc5c(-c6ccc(-c7cc(-c8ccc9c(ccc%10ccccc%109)c8)nc(-c8ccccc8)n7)cc6)cccc45)cc3)cc(-c3ccc4c(ccc5ccccc54)c3)n2)cc1 |
| InChI | InChI=1S/C70H44N4/c1-3-15-51(16-4-1)69-71-65(43-67(73-69)55-37-39-61-53(41-55)35-29-45-13-7-9-19-57(45)61)49-31-25-47(26-32-49)59-21-11-24-64-60(22-12-23-63(59)64)48-27-33-50(34-28-48)66-44-68(74-70(72-66)52-17-5-2-6-18-52)56-38-40-62-54(42-56)36-30-46-14-8-10-20-58(46)62/h1-44H |
| InChIKey | SFJIFFJLNDGVBR-UHFFFAOYSA-N |
| XLogP | 18.37 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 941.15 |
| LogP ≤ 5 | 18.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|