C8H8F4 — CID 122448094
(3E,5Z)-4,5,6,7-tetrafluoro-3-methylhepta-1,3,5-triene (PubChem CID 122448094) has the molecular formula C8H8F4 and a molecular weight of 180.14 g/mol. Its IUPAC name is (3E,5Z)-4,5,6,7-tetrafluoro-3-methylhepta-1,3,5-triene.
| Compound Name | (3E,5Z)-4,5,6,7-tetrafluoro-3-methylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 122448094 |
| Molecular Formula | C8H8F4 |
| Molecular Weight | 180.14 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | (3E,5Z)-4,5,6,7-tetrafluoro-3-methylhepta-1,3,5-triene |
| SMILES | C=C/C(C)=C(F)\C(F)=C(\F)CF |
| InChI | InChI=1S/C8H8F4/c1-3-5(2)7(11)8(12)6(10)4-9/h3H,1,4H2,2H3/b7-5+,8-6- |
| InChIKey | RZANUKUKFODFEC-YMBWGVAGSA-N |
| XLogP | 3.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.14 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|