C37H31N3O3 — CID 122448106
(5E)-2-(2-benzoylphenyl)imino-5-[[4-(N-cyclohexa-2,4-dien-1-ylanilino)phenyl]methylidene]-3-ethyl-1,3-oxazolidin-4-one (PubChem CID 122448106) has the molecular formula C37H31N3O3 and a molecular weight of 565.67 g/mol. Its IUPAC name is (5E)-2-(2-benzoylphenyl)imino-5-[[4-(N-cyclohexa-2,4-dien-1-ylanilino)phenyl]methylidene]-3-ethyl-1,3-oxazolidin-4-one.
| Compound Name | (5E)-2-(2-benzoylphenyl)imino-5-[[4-(N-cyclohexa-2,4-dien-1-ylanilino)phenyl]methylidene]-3-ethyl-1,3-oxazolidin-4-one |
|---|---|
| PubChem CID | 122448106 |
| Molecular Formula | C37H31N3O3 |
| Molecular Weight | 565.67 g/mol |
| Exact Mass | 565.24 |
| IUPAC Name | (5E)-2-(2-benzoylphenyl)imino-5-[[4-(N-cyclohexa-2,4-dien-1-ylanilino)phenyl]methylidene]-3-ethyl-1,3-oxazolidin-4-one |
| SMILES | CCN1C(=O)/C(=C\c2ccc(N(c3ccccc3)C3C=CC=CC3)cc2)O/C1=N\c1ccccc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C37H31N3O3/c1-2-39-36(42)34(43-37(39)38-33-21-13-12-20-32(33)35(41)28-14-6-3-7-15-28)26-27-22-24-31(25-23-27)40(29-16-8-4-9-17-29)30-18-10-5-11-19-30/h3-18,20-26,30H,2,19H2,1H3/b34-26+,38-37- |
| InChIKey | ZDDIUNGLVGPKEG-LCLSSZJLSA-N |
| XLogP | 7.85 |
| TPSA | 62.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.67 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|