About 4-(azidomethyl)-5-(nitrosomethyl)-1,3-dioxol-2-one
4-(azidomethyl)-5-(nitrosomethyl)-1,3-dioxol-2-one (PubChem CID 122448192) has the molecular formula C5H4N4O4
and a molecular weight of 184.11 g/mol. Its IUPAC name is 4-(azidomethyl)-5-(nitrosomethyl)-1,3-dioxol-2-one.
Molecular Properties
| Compound Name | 4-(azidomethyl)-5-(nitrosomethyl)-1,3-dioxol-2-one |
| PubChem CID | 122448192 |
| Molecular Formula | C5H4N4O4 |
| Molecular Weight | 184.11 g/mol |
| Exact Mass | 184.02 |
| IUPAC Name | 4-(azidomethyl)-5-(nitrosomethyl)-1,3-dioxol-2-one |
| SMILES | [N-]=[N+]=NCc1oc(=O)oc1CN=O |
| InChI | InChI=1S/C5H4N4O4/c6-9-7-1-3-4(2-8-11)13-5(10)12-3/h1-2H2 |
| InChIKey | SGCGSQMOSPIXPJ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 121.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.11 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 4-(azidomethyl)-5-(nitrosomethyl)-1,3-dioxol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(azidomethyl)-5-(nitrosomethyl)-1,3-dioxol-2-one?
The IUPAC name of 4-(azidomethyl)-5-(nitrosomethyl)-1,3-dioxol-2-one (CID 122448192) is 4-(azidomethyl)-5-(nitrosomethyl)-1,3-dioxol-2-one.
What is the SMILES notation for 4-(azidomethyl)-5-(nitrosomethyl)-1,3-dioxol-2-one?
The canonical SMILES for 4-(azidomethyl)-5-(nitrosomethyl)-1,3-dioxol-2-one is [N-]=[N+]=NCc1oc(=O)oc1CN=O.
What is the InChIKey of 4-(azidomethyl)-5-(nitrosomethyl)-1,3-dioxol-2-one?
The InChIKey is SGCGSQMOSPIXPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N4O4/c6-9-7-1-3-4(2-8-11)13-5(10)12-3/h1-2H2.
What are the key properties of 4-(azidomethyl)-5-(nitrosomethyl)-1,3-dioxol-2-one?
4-(azidomethyl)-5-(nitrosomethyl)-1,3-dioxol-2-one has a molecular weight of 184.11 g/mol, XLogP of 1.31, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(azidomethyl)-5-(nitrosomethyl)-1,3-dioxol-2-one is sourced from PubChem (CID 122448192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).