About N-(2,3-dihydropyridin-3-yl)ethanethioamide
N-(2,3-dihydropyridin-3-yl)ethanethioamide (PubChem CID 122448250) has the molecular formula C7H10N2S
and a molecular weight of 154.24 g/mol. Its IUPAC name is N-(2,3-dihydropyridin-3-yl)ethanethioamide.
Molecular Properties
| Compound Name | N-(2,3-dihydropyridin-3-yl)ethanethioamide |
| PubChem CID | 122448250 |
| Molecular Formula | C7H10N2S |
| Molecular Weight | 154.24 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | N-(2,3-dihydropyridin-3-yl)ethanethioamide |
| SMILES | CC(=S)NC1C=CC=NC1 |
| InChI | InChI=1S/C7H10N2S/c1-6(10)9-7-3-2-4-8-5-7/h2-4,7H,5H2,1H3,(H,9,10) |
| InChIKey | APDNJLIOZRBOQB-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.24 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-(2,3-dihydropyridin-3-yl)ethanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,3-dihydropyridin-3-yl)ethanethioamide?
The IUPAC name of N-(2,3-dihydropyridin-3-yl)ethanethioamide (CID 122448250) is N-(2,3-dihydropyridin-3-yl)ethanethioamide.
What is the SMILES notation for N-(2,3-dihydropyridin-3-yl)ethanethioamide?
The canonical SMILES for N-(2,3-dihydropyridin-3-yl)ethanethioamide is CC(=S)NC1C=CC=NC1.
What is the InChIKey of N-(2,3-dihydropyridin-3-yl)ethanethioamide?
The InChIKey is APDNJLIOZRBOQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2S/c1-6(10)9-7-3-2-4-8-5-7/h2-4,7H,5H2,1H3,(H,9,10).
What are the key properties of N-(2,3-dihydropyridin-3-yl)ethanethioamide?
N-(2,3-dihydropyridin-3-yl)ethanethioamide has a molecular weight of 154.24 g/mol, XLogP of 0.93, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,3-dihydropyridin-3-yl)ethanethioamide is sourced from PubChem (CID 122448250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).