About [2-(difluoromethyl)-6-(4-methylsulfonylphenyl)-5-phenylpyrimidin-4-yl] 2-fluorobenzenesulfonate
[2-(difluoromethyl)-6-(4-methylsulfonylphenyl)-5-phenylpyrimidin-4-yl] 2-fluorobenzenesulfonate (PubChem CID 122448612) has the molecular formula C24H17F3N2O5S2
and a molecular weight of 534.54 g/mol. Its IUPAC name is [2-(difluoromethyl)-6-(4-methylsulfonylphenyl)-5-phenylpyrimidin-4-yl] 2-fluorobenzenesulfonate.
Molecular Properties
| Compound Name | [2-(difluoromethyl)-6-(4-methylsulfonylphenyl)-5-phenylpyrimidin-4-yl] 2-fluorobenzenesulfonate |
| PubChem CID | 122448612 |
| Molecular Formula | C24H17F3N2O5S2 |
| Molecular Weight | 534.54 g/mol |
| Exact Mass | 534.05 |
| IUPAC Name | [2-(difluoromethyl)-6-(4-methylsulfonylphenyl)-5-phenylpyrimidin-4-yl] 2-fluorobenzenesulfonate |
| SMILES | CS(=O)(=O)c1ccc(-c2nc(C(F)F)nc(OS(=O)(=O)c3ccccc3F)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H17F3N2O5S2/c1-35(30,31)17-13-11-16(12-14-17)21-20(15-7-3-2-4-8-15)24(29-23(28-21)22(26)27)34-36(32,33)19-10-6-5-9-18(19)25/h2-14,22H,1H3 |
| InChIKey | HLWSAWXJVMKSCX-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 103.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 534.54 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [2-(difluoromethyl)-6-(4-methylsulfonylphenyl)-5-phenylpyrimidin-4-yl] 2-fluorobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(difluoromethyl)-6-(4-methylsulfonylphenyl)-5-phenylpyrimidin-4-yl] 2-fluorobenzenesulfonate?
The IUPAC name of [2-(difluoromethyl)-6-(4-methylsulfonylphenyl)-5-phenylpyrimidin-4-yl] 2-fluorobenzenesulfonate (CID 122448612) is [2-(difluoromethyl)-6-(4-methylsulfonylphenyl)-5-phenylpyrimidin-4-yl] 2-fluorobenzenesulfonate.
What is the SMILES notation for [2-(difluoromethyl)-6-(4-methylsulfonylphenyl)-5-phenylpyrimidin-4-yl] 2-fluorobenzenesulfonate?
The canonical SMILES for [2-(difluoromethyl)-6-(4-methylsulfonylphenyl)-5-phenylpyrimidin-4-yl] 2-fluorobenzenesulfonate is CS(=O)(=O)c1ccc(-c2nc(C(F)F)nc(OS(=O)(=O)c3ccccc3F)c2-c2ccccc2)cc1.
What is the InChIKey of [2-(difluoromethyl)-6-(4-methylsulfonylphenyl)-5-phenylpyrimidin-4-yl] 2-fluorobenzenesulfonate?
The InChIKey is HLWSAWXJVMKSCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H17F3N2O5S2/c1-35(30,31)17-13-11-16(12-14-17)21-20(15-7-3-2-4-8-15)24(29-23(28-21)22(26)27)34-36(32,33)19-10-6-5-9-18(19)25/h2-14,22H,1H3.
What are the key properties of [2-(difluoromethyl)-6-(4-methylsulfonylphenyl)-5-phenylpyrimidin-4-yl] 2-fluorobenzenesulfonate?
[2-(difluoromethyl)-6-(4-methylsulfonylphenyl)-5-phenylpyrimidin-4-yl] 2-fluorobenzenesulfonate has a molecular weight of 534.54 g/mol, XLogP of 5.06, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(difluoromethyl)-6-(4-methylsulfonylphenyl)-5-phenylpyrimidin-4-yl] 2-fluorobenzenesulfonate is sourced from PubChem (CID 122448612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).