C50H36N2 — CID 122448830
N-[4-[4-[N-(9bH-phenalen-2-yl)anilino]phenyl]phenyl]-N-phenyl-9bH-phenalen-2-amine (PubChem CID 122448830) has the molecular formula C50H36N2 and a molecular weight of 664.85 g/mol. Its IUPAC name is N-[4-[4-[N-(9bH-phenalen-2-yl)anilino]phenyl]phenyl]-N-phenyl-9bH-phenalen-2-amine.
| Compound Name | N-[4-[4-[N-(9bH-phenalen-2-yl)anilino]phenyl]phenyl]-N-phenyl-9bH-phenalen-2-amine |
|---|---|
| PubChem CID | 122448830 |
| Molecular Formula | C50H36N2 |
| Molecular Weight | 664.85 g/mol |
| Exact Mass | 664.29 |
| IUPAC Name | N-[4-[4-[N-(9bH-phenalen-2-yl)anilino]phenyl]phenyl]-N-phenyl-9bH-phenalen-2-amine |
| SMILES | C1=CC2=CC=CC3=CC(N(c4ccccc4)c4ccc(-c5ccc(N(C6=CC7=CC=CC8=CC=CC(=C6)C87)c6ccccc6)cc5)cc4)=CC(=C1)C23 |
| InChI | InChI=1S/C50H36N2/c1-3-19-43(20-4-1)51(47-31-39-15-7-11-37-12-8-16-40(32-47)49(37)39)45-27-23-35(24-28-45)36-25-29-46(30-26-36)52(44-21-5-2-6-22-44)48-33-41-17-9-13-38-14-10-18-42(34-48)50(38)41/h1-34,49-50H |
| InChIKey | BMCPURVLBPKMFZ-UHFFFAOYSA-N |
| XLogP | 12.49 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.85 |
| LogP ≤ 5 | 12.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |