C24H18F2N6 — CID 122449242
7-fluoro-2-(2-fluorophenyl)-3-[1-(7H-purin-6-yl)pyrrolidin-2-yl]quinoline (PubChem CID 122449242) has the molecular formula C24H18F2N6 and a molecular weight of 428.45 g/mol. Its IUPAC name is 7-fluoro-2-(2-fluorophenyl)-3-[1-(7H-purin-6-yl)pyrrolidin-2-yl]quinoline.
| Compound Name | 7-fluoro-2-(2-fluorophenyl)-3-[1-(7H-purin-6-yl)pyrrolidin-2-yl]quinoline |
|---|---|
| PubChem CID | 122449242 |
| Molecular Formula | C24H18F2N6 |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | 7-fluoro-2-(2-fluorophenyl)-3-[1-(7H-purin-6-yl)pyrrolidin-2-yl]quinoline |
| SMILES | Fc1ccc2cc(C3CCCN3c3ncnc4nc[nH]c34)c(-c3ccccc3F)nc2c1 |
| InChI | InChI=1S/C24H18F2N6/c25-15-8-7-14-10-17(21(31-19(14)11-15)16-4-1-2-5-18(16)26)20-6-3-9-32(20)24-22-23(28-12-27-22)29-13-30-24/h1-2,4-5,7-8,10-13,20H,3,6,9H2,(H,27,28,29,30) |
| InChIKey | ZIGNVFRIBRKTSA-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |