C36H31NO2S3 — CID 122449553
2-[[5-[7-(3,5-ditert-butylphenyl)-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]thiophen-2-yl]methylidene]indene-1,3-dione (PubChem CID 122449553) has the molecular formula C36H31NO2S3 and a molecular weight of 605.85 g/mol. Its IUPAC name is 2-[[5-[7-(3,5-ditert-butylphenyl)-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]thiophen-2-yl]methylidene]indene-1,3-dione.
| Compound Name | 2-[[5-[7-(3,5-ditert-butylphenyl)-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]thiophen-2-yl]methylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 122449553 |
| Molecular Formula | C36H31NO2S3 |
| Molecular Weight | 605.85 g/mol |
| Exact Mass | 605.15 |
| IUPAC Name | 2-[[5-[7-(3,5-ditert-butylphenyl)-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]thiophen-2-yl]methylidene]indene-1,3-dione |
| SMILES | CC(C)(C)c1cc(-n2c3ccsc3c3sc(-c4ccc(C=C5C(=O)c6ccccc6C5=O)s4)cc32)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C36H31NO2S3/c1-35(2,3)20-15-21(36(4,5)6)17-22(16-20)37-27-13-14-40-33(27)34-28(37)19-30(42-34)29-12-11-23(41-29)18-26-31(38)24-9-7-8-10-25(24)32(26)39/h7-19H,1-6H3 |
| InChIKey | GQAJRADUAMYDHA-UHFFFAOYSA-N |
| XLogP | 10.69 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.85 |
| LogP ≤ 5 | 10.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|