C10H12F3N3O3S — CID 122450026
4-amino-1-[(2R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-(trifluoromethyl)oxolan-2-yl]pyrimidine-2-thione (PubChem CID 122450026) has the molecular formula C10H12F3N3O3S and a molecular weight of 311.29 g/mol. Its IUPAC name is 4-amino-1-[(2R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-(trifluoromethyl)oxolan-2-yl]pyrimidine-2-thione.
| Compound Name | 4-amino-1-[(2R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-(trifluoromethyl)oxolan-2-yl]pyrimidine-2-thione |
|---|---|
| PubChem CID | 122450026 |
| Molecular Formula | C10H12F3N3O3S |
| Molecular Weight | 311.29 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 4-amino-1-[(2R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-(trifluoromethyl)oxolan-2-yl]pyrimidine-2-thione |
| SMILES | Nc1ccn([C@@H]2O[C@H](CO)[C@H](O)C2C(F)(F)F)c(=S)n1 |
| InChI | InChI=1S/C10H12F3N3O3S/c11-10(12,13)6-7(18)4(3-17)19-8(6)16-2-1-5(14)15-9(16)20/h1-2,4,6-8,17-18H,3H2,(H2,14,15,20)/t4-,6?,7+,8-/m1/s1 |
| InChIKey | WFPWSJZGAOPNSH-PDVZPSIWSA-N |
| XLogP | 0.62 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.29 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|