About 2-(6-phenyl-1,2,4,5-tetrazin-3-yl)ethanol
2-(6-phenyl-1,2,4,5-tetrazin-3-yl)ethanol (PubChem CID 122450345) has the molecular formula C10H10N4O
and a molecular weight of 202.22 g/mol. Its IUPAC name is 2-(6-phenyl-1,2,4,5-tetrazin-3-yl)ethanol.
Molecular Properties
| Compound Name | 2-(6-phenyl-1,2,4,5-tetrazin-3-yl)ethanol |
| PubChem CID | 122450345 |
| Molecular Formula | C10H10N4O |
| Molecular Weight | 202.22 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | 2-(6-phenyl-1,2,4,5-tetrazin-3-yl)ethanol |
| SMILES | OCCc1nnc(-c2ccccc2)nn1 |
| InChI | InChI=1S/C10H10N4O/c15-7-6-9-11-13-10(14-12-9)8-4-2-1-3-5-8/h1-5,15H,6-7H2 |
| InChIKey | MHNOKHWPTFQBDT-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 71.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.22 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(6-phenyl-1,2,4,5-tetrazin-3-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-phenyl-1,2,4,5-tetrazin-3-yl)ethanol?
The IUPAC name of 2-(6-phenyl-1,2,4,5-tetrazin-3-yl)ethanol (CID 122450345) is 2-(6-phenyl-1,2,4,5-tetrazin-3-yl)ethanol.
What is the SMILES notation for 2-(6-phenyl-1,2,4,5-tetrazin-3-yl)ethanol?
The canonical SMILES for 2-(6-phenyl-1,2,4,5-tetrazin-3-yl)ethanol is OCCc1nnc(-c2ccccc2)nn1.
What is the InChIKey of 2-(6-phenyl-1,2,4,5-tetrazin-3-yl)ethanol?
The InChIKey is MHNOKHWPTFQBDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N4O/c15-7-6-9-11-13-10(14-12-9)8-4-2-1-3-5-8/h1-5,15H,6-7H2.
What are the key properties of 2-(6-phenyl-1,2,4,5-tetrazin-3-yl)ethanol?
2-(6-phenyl-1,2,4,5-tetrazin-3-yl)ethanol has a molecular weight of 202.22 g/mol, XLogP of 0.47, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-phenyl-1,2,4,5-tetrazin-3-yl)ethanol is sourced from PubChem (CID 122450345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).