C16H15F5O5 — CID 122450375
(2,3,4,5,6-pentafluorophenyl) 4,4,5,6,6-pentamethyl-2-oxo-1,3-dioxane-5-carboxylate (PubChem CID 122450375) has the molecular formula C16H15F5O5 and a molecular weight of 382.28 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 4,4,5,6,6-pentamethyl-2-oxo-1,3-dioxane-5-carboxylate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 4,4,5,6,6-pentamethyl-2-oxo-1,3-dioxane-5-carboxylate |
|---|---|
| PubChem CID | 122450375 |
| Molecular Formula | C16H15F5O5 |
| Molecular Weight | 382.28 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 4,4,5,6,6-pentamethyl-2-oxo-1,3-dioxane-5-carboxylate |
| SMILES | CC1(C)OC(=O)OC(C)(C)C1(C)C(=O)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C16H15F5O5/c1-14(2)16(5,15(3,4)26-13(23)25-14)12(22)24-11-9(20)7(18)6(17)8(19)10(11)21/h1-5H3 |
| InChIKey | CXFDDHQMSJXLKS-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.28 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|