C11H8F14O5 — CID 122450404
methyl [2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2-tetrafluoropropoxy)propoxy]propyl] carbonate (PubChem CID 122450404) has the molecular formula C11H8F14O5 and a molecular weight of 486.15 g/mol. Its IUPAC name is methyl [2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2-tetrafluoropropoxy)propoxy]propyl] carbonate.
| Compound Name | methyl [2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2-tetrafluoropropoxy)propoxy]propyl] carbonate |
|---|---|
| PubChem CID | 122450404 |
| Molecular Formula | C11H8F14O5 |
| Molecular Weight | 486.15 g/mol |
| Exact Mass | 486.01 |
| IUPAC Name | methyl [2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2-tetrafluoropropoxy)propoxy]propyl] carbonate |
| SMILES | COC(=O)OCC(F)(OC(F)(F)C(F)(OC(F)(F)C(C)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H8F14O5/c1-5(12,13)10(22,23)30-7(15,9(19,20)21)11(24,25)29-6(14,8(16,17)18)3-28-4(26)27-2/h3H2,1-2H3 |
| InChIKey | RQTMQZHKZLERGJ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.15 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|