About 4-[(2,2-difluoro-3-methylbutoxy)methyl]-1,3-dioxolan-2-one
4-[(2,2-difluoro-3-methylbutoxy)methyl]-1,3-dioxolan-2-one (PubChem CID 122450409) has the molecular formula C9H14F2O4
and a molecular weight of 224.20 g/mol. Its IUPAC name is 4-[(2,2-difluoro-3-methylbutoxy)methyl]-1,3-dioxolan-2-one.
Molecular Properties
| Compound Name | 4-[(2,2-difluoro-3-methylbutoxy)methyl]-1,3-dioxolan-2-one |
| PubChem CID | 122450409 |
| Molecular Formula | C9H14F2O4 |
| Molecular Weight | 224.20 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | 4-[(2,2-difluoro-3-methylbutoxy)methyl]-1,3-dioxolan-2-one |
| SMILES | CC(C)C(F)(F)COCC1COC(=O)O1 |
| InChI | InChI=1S/C9H14F2O4/c1-6(2)9(10,11)5-13-3-7-4-14-8(12)15-7/h6-7H,3-5H2,1-2H3 |
| InChIKey | XUJGEIMWFTYRSX-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.20 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(2,2-difluoro-3-methylbutoxy)methyl]-1,3-dioxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,2-difluoro-3-methylbutoxy)methyl]-1,3-dioxolan-2-one?
The IUPAC name of 4-[(2,2-difluoro-3-methylbutoxy)methyl]-1,3-dioxolan-2-one (CID 122450409) is 4-[(2,2-difluoro-3-methylbutoxy)methyl]-1,3-dioxolan-2-one.
What is the SMILES notation for 4-[(2,2-difluoro-3-methylbutoxy)methyl]-1,3-dioxolan-2-one?
The canonical SMILES for 4-[(2,2-difluoro-3-methylbutoxy)methyl]-1,3-dioxolan-2-one is CC(C)C(F)(F)COCC1COC(=O)O1.
What is the InChIKey of 4-[(2,2-difluoro-3-methylbutoxy)methyl]-1,3-dioxolan-2-one?
The InChIKey is XUJGEIMWFTYRSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14F2O4/c1-6(2)9(10,11)5-13-3-7-4-14-8(12)15-7/h6-7H,3-5H2,1-2H3.
What are the key properties of 4-[(2,2-difluoro-3-methylbutoxy)methyl]-1,3-dioxolan-2-one?
4-[(2,2-difluoro-3-methylbutoxy)methyl]-1,3-dioxolan-2-one has a molecular weight of 224.20 g/mol, XLogP of 1.83, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,2-difluoro-3-methylbutoxy)methyl]-1,3-dioxolan-2-one is sourced from PubChem (CID 122450409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).