About 2-(2,2-difluoro-3-methylbutoxy)-N,N-dimethylacetamide
2-(2,2-difluoro-3-methylbutoxy)-N,N-dimethylacetamide (PubChem CID 122450417) has the molecular formula C9H17F2NO2
and a molecular weight of 209.24 g/mol. Its IUPAC name is 2-(2,2-difluoro-3-methylbutoxy)-N,N-dimethylacetamide.
Molecular Properties
| Compound Name | 2-(2,2-difluoro-3-methylbutoxy)-N,N-dimethylacetamide |
| PubChem CID | 122450417 |
| Molecular Formula | C9H17F2NO2 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 2-(2,2-difluoro-3-methylbutoxy)-N,N-dimethylacetamide |
| SMILES | CC(C)C(F)(F)COCC(=O)N(C)C |
| InChI | InChI=1S/C9H17F2NO2/c1-7(2)9(10,11)6-14-5-8(13)12(3)4/h7H,5-6H2,1-4H3 |
| InChIKey | RAFXIHWKCPCQPQ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(2,2-difluoro-3-methylbutoxy)-N,N-dimethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2-difluoro-3-methylbutoxy)-N,N-dimethylacetamide?
The IUPAC name of 2-(2,2-difluoro-3-methylbutoxy)-N,N-dimethylacetamide (CID 122450417) is 2-(2,2-difluoro-3-methylbutoxy)-N,N-dimethylacetamide.
What is the SMILES notation for 2-(2,2-difluoro-3-methylbutoxy)-N,N-dimethylacetamide?
The canonical SMILES for 2-(2,2-difluoro-3-methylbutoxy)-N,N-dimethylacetamide is CC(C)C(F)(F)COCC(=O)N(C)C.
What is the InChIKey of 2-(2,2-difluoro-3-methylbutoxy)-N,N-dimethylacetamide?
The InChIKey is RAFXIHWKCPCQPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17F2NO2/c1-7(2)9(10,11)6-14-5-8(13)12(3)4/h7H,5-6H2,1-4H3.
What are the key properties of 2-(2,2-difluoro-3-methylbutoxy)-N,N-dimethylacetamide?
2-(2,2-difluoro-3-methylbutoxy)-N,N-dimethylacetamide has a molecular weight of 209.24 g/mol, XLogP of 1.38, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-difluoro-3-methylbutoxy)-N,N-dimethylacetamide is sourced from PubChem (CID 122450417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).