C11H11F14O6P — CID 122450437
dimethyl [2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2-tetrafluoropropoxy)propoxy]propyl] phosphate (PubChem CID 122450437) has the molecular formula C11H11F14O6P and a molecular weight of 536.15 g/mol. Its IUPAC name is dimethyl [2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2-tetrafluoropropoxy)propoxy]propyl] phosphate.
| Compound Name | dimethyl [2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2-tetrafluoropropoxy)propoxy]propyl] phosphate |
|---|---|
| PubChem CID | 122450437 |
| Molecular Formula | C11H11F14O6P |
| Molecular Weight | 536.15 g/mol |
| Exact Mass | 536.01 |
| IUPAC Name | dimethyl [2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2-tetrafluoropropoxy)propoxy]propyl] phosphate |
| SMILES | COP(=O)(OC)OCC(F)(OC(F)(F)C(F)(OC(F)(F)C(C)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H11F14O6P/c1-5(12,13)10(22,23)31-7(15,9(19,20)21)11(24,25)30-6(14,8(16,17)18)4-29-32(26,27-2)28-3/h4H2,1-3H3 |
| InChIKey | XNTNDLCQRLVCPN-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.15 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|