About N'-methyl-N-propan-2-yl-N'-[(propan-2-ylamino)methyl]methanediamine
N'-methyl-N-propan-2-yl-N'-[(propan-2-ylamino)methyl]methanediamine (PubChem CID 122450469) has the molecular formula C9H23N3
and a molecular weight of 173.30 g/mol. Its IUPAC name is N'-methyl-N-propan-2-yl-N'-[(propan-2-ylamino)methyl]methanediamine.
Molecular Properties
| Compound Name | N'-methyl-N-propan-2-yl-N'-[(propan-2-ylamino)methyl]methanediamine |
| PubChem CID | 122450469 |
| Molecular Formula | C9H23N3 |
| Molecular Weight | 173.30 g/mol |
| Exact Mass | 173.19 |
| IUPAC Name | N'-methyl-N-propan-2-yl-N'-[(propan-2-ylamino)methyl]methanediamine |
| SMILES | CC(C)NCN(C)CNC(C)C |
| InChI | InChI=1S/C9H23N3/c1-8(2)10-6-12(5)7-11-9(3)4/h8-11H,6-7H2,1-5H3 |
| InChIKey | FJMHMVKYBCUNJC-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.30 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N'-methyl-N-propan-2-yl-N'-[(propan-2-ylamino)methyl]methanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-methyl-N-propan-2-yl-N'-[(propan-2-ylamino)methyl]methanediamine?
The IUPAC name of N'-methyl-N-propan-2-yl-N'-[(propan-2-ylamino)methyl]methanediamine (CID 122450469) is N'-methyl-N-propan-2-yl-N'-[(propan-2-ylamino)methyl]methanediamine.
What is the SMILES notation for N'-methyl-N-propan-2-yl-N'-[(propan-2-ylamino)methyl]methanediamine?
The canonical SMILES for N'-methyl-N-propan-2-yl-N'-[(propan-2-ylamino)methyl]methanediamine is CC(C)NCN(C)CNC(C)C.
What is the InChIKey of N'-methyl-N-propan-2-yl-N'-[(propan-2-ylamino)methyl]methanediamine?
The InChIKey is FJMHMVKYBCUNJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H23N3/c1-8(2)10-6-12(5)7-11-9(3)4/h8-11H,6-7H2,1-5H3.
What are the key properties of N'-methyl-N-propan-2-yl-N'-[(propan-2-ylamino)methyl]methanediamine?
N'-methyl-N-propan-2-yl-N'-[(propan-2-ylamino)methyl]methanediamine has a molecular weight of 173.30 g/mol, XLogP of 0.83, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-methyl-N-propan-2-yl-N'-[(propan-2-ylamino)methyl]methanediamine is sourced from PubChem (CID 122450469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).