C26H35N3O — CID 122450867
(2S)-1-[(2S,3aS,7aS)-2-(7-methyl-4,5-dihydro-3H-benzo[e]benzimidazol-2-yl)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-2,3-dimethylbutan-1-one (PubChem CID 122450867) has the molecular formula C26H35N3O and a molecular weight of 405.59 g/mol. Its IUPAC name is (2S)-1-[(2S,3aS,7aS)-2-(7-methyl-4,5-dihydro-3H-benzo[e]benzimidazol-2-yl)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-2,3-dimethylbutan-1-one.
| Compound Name | (2S)-1-[(2S,3aS,7aS)-2-(7-methyl-4,5-dihydro-3H-benzo[e]benzimidazol-2-yl)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-2,3-dimethylbutan-1-one |
|---|---|
| PubChem CID | 122450867 |
| Molecular Formula | C26H35N3O |
| Molecular Weight | 405.59 g/mol |
| Exact Mass | 405.28 |
| IUPAC Name | (2S)-1-[(2S,3aS,7aS)-2-(7-methyl-4,5-dihydro-3H-benzo[e]benzimidazol-2-yl)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-2,3-dimethylbutan-1-one |
| SMILES | Cc1ccc2c(c1)CCc1[nH]c([C@@H]3C[C@@H]4CCCC[C@@H]4N3C(=O)[C@@H](C)C(C)C)nc1-2 |
| InChI | InChI=1S/C26H35N3O/c1-15(2)17(4)26(30)29-22-8-6-5-7-19(22)14-23(29)25-27-21-12-10-18-13-16(3)9-11-20(18)24(21)28-25/h9,11,13,15,17,19,22-23H,5-8,10,12,14H2,1-4H3,(H,27,28)/t17-,19-,22-,23-/m0/s1 |
| InChIKey | NZYBACFKYJKKEY-UJFGGOPNSA-N |
| XLogP | 5.61 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.59 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |